C13H18O3 — CID 24812581
(3aS,8bR)-3a,6,6-trimethyl-2,5,7,8b-tetrahydro-1H-furo[2,3-b][1]benzofuran-8-one (PubChem CID 24812581) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3aS,8bR)-3a,6,6-trimethyl-2,5,7,8b-tetrahydro-1H-furo[2,3-b][1]benzofuran-8-one.
| Compound Name | (3aS,8bR)-3a,6,6-trimethyl-2,5,7,8b-tetrahydro-1H-furo[2,3-b][1]benzofuran-8-one |
|---|---|
| PubChem CID | 24812581 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3aS,8bR)-3a,6,6-trimethyl-2,5,7,8b-tetrahydro-1H-furo[2,3-b][1]benzofuran-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@]1(C)OCC[C@H]21 |
| InChI | InChI=1S/C13H18O3/c1-12(2)6-9(14)11-8-4-5-15-13(8,3)16-10(11)7-12/h8H,4-7H2,1-3H3/t8-,13+/m1/s1 |
| InChIKey | FVFDAOIGXXRAHM-OQPBUACISA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |