C15H22O2 — CID 24812678
(2R,7aS)-2-hydroxy-3,5,5,7a-tetramethyl-1,2,3b,4,6,6a-hexahydrocyclopenta[a]pentalen-7-one (PubChem CID 24812678) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2R,7aS)-2-hydroxy-3,5,5,7a-tetramethyl-1,2,3b,4,6,6a-hexahydrocyclopenta[a]pentalen-7-one.
| Compound Name | (2R,7aS)-2-hydroxy-3,5,5,7a-tetramethyl-1,2,3b,4,6,6a-hexahydrocyclopenta[a]pentalen-7-one |
|---|---|
| PubChem CID | 24812678 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2R,7aS)-2-hydroxy-3,5,5,7a-tetramethyl-1,2,3b,4,6,6a-hexahydrocyclopenta[a]pentalen-7-one |
| SMILES | CC1=C2C3CC(C)(C)CC3C(=O)[C@@]2(C)C[C@H]1O |
| InChI | InChI=1S/C15H22O2/c1-8-11(16)7-15(4)12(8)9-5-14(2,3)6-10(9)13(15)17/h9-11,16H,5-7H2,1-4H3/t9?,10?,11-,15+/m1/s1 |
| InChIKey | DMCWLSNRDNSZJO-CFJSVIKSSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|