C20H32O3 — CID 24812681
(4aR,7S)-7-hydroxy-4-[(3R)-5-hydroxy-3-methylpentyl]-3,4a,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-2-one (PubChem CID 24812681) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (4aR,7S)-7-hydroxy-4-[(3R)-5-hydroxy-3-methylpentyl]-3,4a,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-2-one.
| Compound Name | (4aR,7S)-7-hydroxy-4-[(3R)-5-hydroxy-3-methylpentyl]-3,4a,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-2-one |
|---|---|
| PubChem CID | 24812681 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4aR,7S)-7-hydroxy-4-[(3R)-5-hydroxy-3-methylpentyl]-3,4a,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-2-one |
| SMILES | CC1=C(CC[C@@H](C)CCO)[C@@]2(C)CC[C@H](O)C(C)(C)C2=CC1=O |
| InChI | InChI=1S/C20H32O3/c1-13(9-11-21)6-7-15-14(2)16(22)12-17-19(3,4)18(23)8-10-20(15,17)5/h12-13,18,21,23H,6-11H2,1-5H3/t13-,18+,20-/m1/s1 |
| InChIKey | RMASJDSAHYNBOP-ORPRQENYSA-N |
| XLogP | 3.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |