C27H38O6S — CID 24812837
[(2S,3S,4S)-2-methyl-3-phenylmethoxy-4-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentyl] 4-methylbenzenesulfonate (PubChem CID 24812837) has the molecular formula C27H38O6S and a molecular weight of 490.66 g/mol. Its IUPAC name is [(2S,3S,4S)-2-methyl-3-phenylmethoxy-4-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,4S)-2-methyl-3-phenylmethoxy-4-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 24812837 |
| Molecular Formula | C27H38O6S |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [(2S,3S,4S)-2-methyl-3-phenylmethoxy-4-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](C)[C@H](OCc2ccccc2)[C@H](C)[C@H]2OC(C)(C)OC[C@@H]2C)cc1 |
| InChI | InChI=1S/C27H38O6S/c1-19-12-14-24(15-13-19)34(28,29)32-17-21(3)25(30-18-23-10-8-7-9-11-23)22(4)26-20(2)16-31-27(5,6)33-26/h7-15,20-22,25-26H,16-18H2,1-6H3/t20-,21-,22-,25-,26-/m0/s1 |
| InChIKey | BYTWABLXOXGCNW-GIDZJRPFSA-N |
| XLogP | 5.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|