C22H42O7Si — CID 24812898
ethyl (E,5S,7R,9S)-7-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5-(methoxymethoxy)-11-oxoundec-2-enoate (PubChem CID 24812898) has the molecular formula C22H42O7Si and a molecular weight of 446.66 g/mol. Its IUPAC name is ethyl (E,5S,7R,9S)-7-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5-(methoxymethoxy)-11-oxoundec-2-enoate.
| Compound Name | ethyl (E,5S,7R,9S)-7-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5-(methoxymethoxy)-11-oxoundec-2-enoate |
|---|---|
| PubChem CID | 24812898 |
| Molecular Formula | C22H42O7Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | ethyl (E,5S,7R,9S)-7-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5-(methoxymethoxy)-11-oxoundec-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](C[C@@H](C[C@@H](CC=O)OC)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C22H42O7Si/c1-9-27-21(24)12-10-11-19(28-17-25-5)16-20(15-18(26-6)13-14-23)29-30(7,8)22(2,3)4/h10,12,14,18-20H,9,11,13,15-17H2,1-8H3/b12-10+/t18-,19+,20-/m1/s1 |
| InChIKey | SKOHUKBUFWYYDH-DGKQPJMDSA-N |
| XLogP | 4.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|