C15H8BCl2F2N3O2 — CID 24812910
4,12-dichloro-2,2-difluoro-8-(4-nitrophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 24812910) has the molecular formula C15H8BCl2F2N3O2 and a molecular weight of 381.96 g/mol. Its IUPAC name is 4,12-dichloro-2,2-difluoro-8-(4-nitrophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,12-dichloro-2,2-difluoro-8-(4-nitrophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 24812910 |
| Molecular Formula | C15H8BCl2F2N3O2 |
| Molecular Weight | 381.96 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 4,12-dichloro-2,2-difluoro-8-(4-nitrophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | O=[N+]([O-])c1ccc(C2=C3C=CC(Cl)=[N+]3[B-](F)(F)n3c(Cl)ccc32)cc1 |
| InChI | InChI=1S/C15H8BCl2F2N3O2/c17-13-7-5-11-15(9-1-3-10(4-2-9)23(24)25)12-6-8-14(18)22(12)16(19,20)21(11)13/h1-8H |
| InChIKey | TXGXKYZRBFTMMK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 51.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|