C21H32O4 — CID 24813010
(1R,2S,6S,7R,8R,9R,10S,12Z)-3-methoxy-4,9,13-trimethyl-6-prop-1-en-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-diene-9,10-diol (PubChem CID 24813010) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1R,2S,6S,7R,8R,9R,10S,12Z)-3-methoxy-4,9,13-trimethyl-6-prop-1-en-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-diene-9,10-diol.
| Compound Name | (1R,2S,6S,7R,8R,9R,10S,12Z)-3-methoxy-4,9,13-trimethyl-6-prop-1-en-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-diene-9,10-diol |
|---|---|
| PubChem CID | 24813010 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1R,2S,6S,7R,8R,9R,10S,12Z)-3-methoxy-4,9,13-trimethyl-6-prop-1-en-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-diene-9,10-diol |
| SMILES | C=C(C)[C@H]1CC(C)=C(OC)[C@H]2[C@@H]1[C@H]1O[C@@H]2C/C(C)=C\C[C@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C21H32O4/c1-11(2)14-10-13(4)19(24-6)18-15-9-12(3)7-8-16(22)21(5,23)20(25-15)17(14)18/h7,14-18,20,22-23H,1,8-10H2,2-6H3/b12-7-/t14-,15-,16+,17-,18-,20-,21-/m1/s1 |
| InChIKey | FEDPRFUPTDTUDC-BXOBFVNGSA-N |
| XLogP | 3.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|