C16H13F3O4 — CID 24813083
(1R,4R,7S,8R)-8-acetyl-4-hydroxy-7-[4-(trifluoromethyl)phenyl]-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 24813083) has the molecular formula C16H13F3O4 and a molecular weight of 326.27 g/mol. Its IUPAC name is (1R,4R,7S,8R)-8-acetyl-4-hydroxy-7-[4-(trifluoromethyl)phenyl]-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (1R,4R,7S,8R)-8-acetyl-4-hydroxy-7-[4-(trifluoromethyl)phenyl]-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 24813083 |
| Molecular Formula | C16H13F3O4 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (1R,4R,7S,8R)-8-acetyl-4-hydroxy-7-[4-(trifluoromethyl)phenyl]-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | CC(=O)[C@@H]1[C@@H](c2ccc(C(F)(F)F)cc2)[C@H]2C=C[C@]1(O)C(=O)O2 |
| InChI | InChI=1S/C16H13F3O4/c1-8(20)13-12(11-6-7-15(13,22)14(21)23-11)9-2-4-10(5-3-9)16(17,18)19/h2-7,11-13,22H,1H3/t11-,12+,13-,15-/m1/s1 |
| InChIKey | IYYMHEZWLATRRY-QVHKTLOISA-N |
| XLogP | 2.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|