C17H36N2O3Si — CID 24813125
3-[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]propan-1-amine (PubChem CID 24813125) has the molecular formula C17H36N2O3Si and a molecular weight of 344.57 g/mol. Its IUPAC name is 3-[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]propan-1-amine.
| Compound Name | 3-[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 24813125 |
| Molecular Formula | C17H36N2O3Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 3-[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]propan-1-amine |
| SMILES | CC1(C)O[C@H]2[C@H](CN(CCCN)[C@@H]2CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C17H36N2O3Si/c1-16(2,3)23(6,7)20-12-13-15-14(21-17(4,5)22-15)11-19(13)10-8-9-18/h13-15H,8-12,18H2,1-7H3/t13-,14+,15-/m1/s1 |
| InChIKey | FSYZTFYOHXFBHX-QLFBSQMISA-N |
| XLogP | 2.56 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|