C18H34O5 — CID 24813159
(4S,6S)-6-methoxy-7-[(2R,3S,6S)-6-[2-(methoxymethoxy)ethyl]-3-methyloxan-2-yl]hept-1-en-4-ol (PubChem CID 24813159) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is (4S,6S)-6-methoxy-7-[(2R,3S,6S)-6-[2-(methoxymethoxy)ethyl]-3-methyloxan-2-yl]hept-1-en-4-ol.
| Compound Name | (4S,6S)-6-methoxy-7-[(2R,3S,6S)-6-[2-(methoxymethoxy)ethyl]-3-methyloxan-2-yl]hept-1-en-4-ol |
|---|---|
| PubChem CID | 24813159 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (4S,6S)-6-methoxy-7-[(2R,3S,6S)-6-[2-(methoxymethoxy)ethyl]-3-methyloxan-2-yl]hept-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@@H](C[C@H]1O[C@H](CCOCOC)CC[C@@H]1C)OC |
| InChI | InChI=1S/C18H34O5/c1-5-6-15(19)11-17(21-4)12-18-14(2)7-8-16(23-18)9-10-22-13-20-3/h5,14-19H,1,6-13H2,2-4H3/t14-,15-,16-,17-,18+/m0/s1 |
| InChIKey | VVRWUCROZNGFME-KFGODFMUSA-N |
| XLogP | 2.91 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|