C20H38O6 — CID 24813161
(4S,6S,8S)-8-methoxy-9-[(2R,3S,6S)-6-[2-(methoxymethoxy)ethyl]-3-methyloxan-2-yl]non-1-ene-4,6-diol (PubChem CID 24813161) has the molecular formula C20H38O6 and a molecular weight of 374.52 g/mol. Its IUPAC name is (4S,6S,8S)-8-methoxy-9-[(2R,3S,6S)-6-[2-(methoxymethoxy)ethyl]-3-methyloxan-2-yl]non-1-ene-4,6-diol.
| Compound Name | (4S,6S,8S)-8-methoxy-9-[(2R,3S,6S)-6-[2-(methoxymethoxy)ethyl]-3-methyloxan-2-yl]non-1-ene-4,6-diol |
|---|---|
| PubChem CID | 24813161 |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (4S,6S,8S)-8-methoxy-9-[(2R,3S,6S)-6-[2-(methoxymethoxy)ethyl]-3-methyloxan-2-yl]non-1-ene-4,6-diol |
| SMILES | C=CC[C@H](O)C[C@H](O)C[C@@H](C[C@H]1O[C@H](CCOCOC)CC[C@@H]1C)OC |
| InChI | InChI=1S/C20H38O6/c1-5-6-16(21)11-17(22)12-19(24-4)13-20-15(2)7-8-18(26-20)9-10-25-14-23-3/h5,15-22H,1,6-14H2,2-4H3/t15-,16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | SIRQHVWYZSNIKN-RPZLJYRGSA-N |
| XLogP | 2.66 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|