C26H50O7Si — CID 24813298
ethyl (2E,5S,7R,9R,11R,12S)-7-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-9-methoxy-5-(methoxymethoxy)-12-methyltetradeca-2,13-dienoate (PubChem CID 24813298) has the molecular formula C26H50O7Si and a molecular weight of 502.77 g/mol. Its IUPAC name is ethyl (2E,5S,7R,9R,11R,12S)-7-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-9-methoxy-5-(methoxymethoxy)-12-methyltetradeca-2,13-dienoate.
| Compound Name | ethyl (2E,5S,7R,9R,11R,12S)-7-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-9-methoxy-5-(methoxymethoxy)-12-methyltetradeca-2,13-dienoate |
|---|---|
| PubChem CID | 24813298 |
| Molecular Formula | C26H50O7Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | ethyl (2E,5S,7R,9R,11R,12S)-7-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-9-methoxy-5-(methoxymethoxy)-12-methyltetradeca-2,13-dienoate |
| SMILES | C=C[C@H](C)[C@H](O)C[C@H](C[C@H](C[C@H](C/C=C/C(=O)OCC)OCOC)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C26H50O7Si/c1-11-20(3)24(27)18-22(30-8)17-23(33-34(9,10)26(4,5)6)16-21(32-19-29-7)14-13-15-25(28)31-12-2/h11,13,15,20-24,27H,1,12,14,16-19H2,2-10H3/b15-13+/t20-,21-,22-,23-,24+/m0/s1 |
| InChIKey | BPIOTOZSCRXVFN-JXTPMZENSA-N |
| XLogP | 5.24 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|