C32H42O4S2 — CID 24813323
[(2E,6E)-5-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]sulfonylbenzene (PubChem CID 24813323) has the molecular formula C32H42O4S2 and a molecular weight of 554.82 g/mol. Its IUPAC name is [(2E,6E)-5-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]sulfonylbenzene.
| Compound Name | [(2E,6E)-5-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 24813323 |
| Molecular Formula | C32H42O4S2 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | [(2E,6E)-5-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]sulfonylbenzene |
| SMILES | CC1=C(CC/C(C)=C/C(C/C(C)=C/CS(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H42O4S2/c1-25(18-19-31-27(3)13-12-21-32(31,4)5)23-30(38(35,36)29-16-10-7-11-17-29)24-26(2)20-22-37(33,34)28-14-8-6-9-15-28/h6-11,14-17,20,23,30H,12-13,18-19,21-22,24H2,1-5H3/b25-23+,26-20+ |
| InChIKey | FEWVBXZNTULSTK-DPWPWZFLSA-N |
| XLogP | 7.89 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|