C16H28O4 — CID 24813662
(5R,6S)-6-[(E,4S,5R,6S)-7-hydroxy-5-methoxy-4,6-dimethylhept-2-en-2-yl]-5-methyloxan-2-one (PubChem CID 24813662) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (5R,6S)-6-[(E,4S,5R,6S)-7-hydroxy-5-methoxy-4,6-dimethylhept-2-en-2-yl]-5-methyloxan-2-one.
| Compound Name | (5R,6S)-6-[(E,4S,5R,6S)-7-hydroxy-5-methoxy-4,6-dimethylhept-2-en-2-yl]-5-methyloxan-2-one |
|---|---|
| PubChem CID | 24813662 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (5R,6S)-6-[(E,4S,5R,6S)-7-hydroxy-5-methoxy-4,6-dimethylhept-2-en-2-yl]-5-methyloxan-2-one |
| SMILES | CO[C@H]([C@@H](C)/C=C(\C)[C@H]1OC(=O)CC[C@H]1C)[C@@H](C)CO |
| InChI | InChI=1S/C16H28O4/c1-10-6-7-14(18)20-16(10)12(3)8-11(2)15(19-5)13(4)9-17/h8,10-11,13,15-17H,6-7,9H2,1-5H3/b12-8+/t10-,11+,13+,15-,16+/m1/s1 |
| InChIKey | YCNIPWXXQWDAJE-BUMVSRFOSA-N |
| XLogP | 2.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|