C18H11ClF2N4O3 — CID 24814229
2-[4-chloro-3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]isoindole-1,3-dione (PubChem CID 24814229) has the molecular formula C18H11ClF2N4O3 and a molecular weight of 404.76 g/mol. Its IUPAC name is 2-[4-chloro-3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-chloro-3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 24814229 |
| Molecular Formula | C18H11ClF2N4O3 |
| Molecular Weight | 404.76 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-[4-chloro-3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]isoindole-1,3-dione |
| SMILES | Cc1nn(-c2cc(N3C(=O)c4ccccc4C3=O)ccc2Cl)c(=O)n1C(F)F |
| InChI | InChI=1S/C18H11ClF2N4O3/c1-9-22-25(18(28)23(9)17(20)21)14-8-10(6-7-13(14)19)24-15(26)11-4-2-3-5-12(11)16(24)27/h2-8,17H,1H3 |
| InChIKey | IFHYXMIDWSQYHG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|