C18H16Cl2FN5O2S — CID 24814361
2-[[4-amino-5-(2,4-dichloro-5-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 24814361) has the molecular formula C18H16Cl2FN5O2S and a molecular weight of 456.33 g/mol. Its IUPAC name is 2-[[4-amino-5-(2,4-dichloro-5-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2,4-dichloro-5-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24814361 |
| Molecular Formula | C18H16Cl2FN5O2S |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 2-[[4-amino-5-(2,4-dichloro-5-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(-c3cc(F)c(Cl)cc3Cl)n2N)cc1 |
| InChI | InChI=1S/C18H16Cl2FN5O2S/c1-2-28-11-5-3-10(4-6-11)23-16(27)9-29-18-25-24-17(26(18)22)12-7-15(21)14(20)8-13(12)19/h3-8H,2,9,22H2,1H3,(H,23,27) |
| InChIKey | ROEMIUSYSZDAFU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|