C15H22O6 — CID 24814467
[(1S,2R,6R,8S,9R)-4,4-dimethyl-11-oxo-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylpropanoate (PubChem CID 24814467) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is [(1S,2R,6R,8S,9R)-4,4-dimethyl-11-oxo-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,2R,6R,8S,9R)-4,4-dimethyl-11-oxo-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24814467 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(1S,2R,6R,8S,9R)-4,4-dimethyl-11-oxo-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylpropanoate |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](C(=O)C[C@H]3OC(=O)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C15H22O6/c1-14(2,3)13(17)18-8-6-7(16)9-10(8)19-12-11(9)20-15(4,5)21-12/h8-12H,6H2,1-5H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | OPCROCXVGPVXFQ-IYKVGLELSA-N |
| XLogP | 1.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |