C15H5F4NO — CID 24814867
7,8,9,10-tetrafluoro-[1]benzofuro[2,3-b]quinoline (PubChem CID 24814867) has the molecular formula C15H5F4NO and a molecular weight of 291.20 g/mol. Its IUPAC name is 7,8,9,10-tetrafluoro-[1]benzofuro[2,3-b]quinoline.
| Compound Name | 7,8,9,10-tetrafluoro-[1]benzofuro[2,3-b]quinoline |
|---|---|
| PubChem CID | 24814867 |
| Molecular Formula | C15H5F4NO |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 7,8,9,10-tetrafluoro-[1]benzofuro[2,3-b]quinoline |
| SMILES | Fc1c(F)c(F)c2nc3oc4ccccc4c3cc2c1F |
| InChI | InChI=1S/C15H5F4NO/c16-10-8-5-7-6-3-1-2-4-9(6)21-15(7)20-14(8)13(19)12(18)11(10)17/h1-5H |
| InChIKey | DFYBLHZYQCQPNB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|