C19H19NO2 — CID 24814967
1,11-dimethoxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine (PubChem CID 24814967) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1,11-dimethoxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine.
| Compound Name | 1,11-dimethoxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine |
|---|---|
| PubChem CID | 24814967 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1,11-dimethoxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine |
| SMILES | COc1ccc2c(c1)cc1n2CCCc2cccc(OC)c2-1 |
| InChI | InChI=1S/C19H19NO2/c1-21-15-8-9-16-14(11-15)12-17-19-13(6-4-10-20(16)17)5-3-7-18(19)22-2/h3,5,7-9,11-12H,4,6,10H2,1-2H3 |
| InChIKey | HSOMHNVNOBJSHR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |