C24H29N3O5S2 — CID 24815590
[4-[(2S)-2-[[(2S)-2-benzyl-3-methoxypropanoyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 24815590) has the molecular formula C24H29N3O5S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxypropanoyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxypropanoyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24815590 |
| Molecular Formula | C24H29N3O5S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxypropanoyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)[C@H](COC)Cc2ccccc2)n1 |
| InChI | InChI=1S/C24H29N3O5S2/c1-3-20-16-33-24(25-20)22(14-18-9-11-21(12-10-18)27-34(29,30)31)26-23(28)19(15-32-2)13-17-7-5-4-6-8-17/h4-12,16,19,22,27H,3,13-15H2,1-2H3,(H,26,28)(H,29,30,31)/t19-,22-/m0/s1 |
| InChIKey | CANDIHKQTVUGOA-UGKGYDQZSA-N |
| XLogP | 3.83 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|