About 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one
10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one (PubChem CID 24815750) has the molecular formula C24H18O4
and a molecular weight of 370.40 g/mol. Its IUPAC name is 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one.
Molecular Properties
| Compound Name | 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one |
| PubChem CID | 24815750 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one |
| SMILES | COc1ccc(C(=O)C=C2c3ccccc3C(=O)c3ccccc32)cc1OC |
| InChI | InChI=1S/C24H18O4/c1-27-22-12-11-15(13-23(22)28-2)21(25)14-20-16-7-3-5-9-18(16)24(26)19-10-6-4-8-17(19)20/h3-14H,1-2H3 |
| InChIKey | OUWLSYCDQQYDBG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one?
The IUPAC name of 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one (CID 24815750) is 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one.
What is the SMILES notation for 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one?
The canonical SMILES for 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one is COc1ccc(C(=O)C=C2c3ccccc3C(=O)c3ccccc32)cc1OC.
What is the InChIKey of 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one?
The InChIKey is OUWLSYCDQQYDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O4/c1-27-22-12-11-15(13-23(22)28-2)21(25)14-20-16-7-3-5-9-18(16)24(26)19-10-6-4-8-17(19)20/h3-14H,1-2H3.
What are the key properties of 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one?
10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one has a molecular weight of 370.40 g/mol, XLogP of 4.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[2-(3,4-dimethoxyphenyl)-2-oxoethylidene]anthracen-9-one is sourced from PubChem (CID 24815750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).