C24H26N4O2S2 — CID 24815862
2,4-dimethyl-N-[[(1R,2S,5S)-3-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-1,3-thiazole-5-carboxamide (PubChem CID 24815862) has the molecular formula C24H26N4O2S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2,4-dimethyl-N-[[(1R,2S,5S)-3-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[[(1R,2S,5S)-3-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24815862 |
| Molecular Formula | C24H26N4O2S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 2,4-dimethyl-N-[[(1R,2S,5S)-3-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cccc(-c2sc(C)nc2C(=O)N2C[C@H]3C[C@H]3[C@H]2CNC(=O)c2sc(C)nc2C)c1 |
| InChI | InChI=1S/C24H26N4O2S2/c1-12-6-5-7-16(8-12)22-20(27-15(4)32-22)24(30)28-11-17-9-18(17)19(28)10-25-23(29)21-13(2)26-14(3)31-21/h5-8,17-19H,9-11H2,1-4H3,(H,25,29)/t17-,18-,19-/m1/s1 |
| InChIKey | RVFPZQLXWDYRPU-GUDVDZBRSA-N |
| XLogP | 4.39 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |