C26H26N4O5S3 — CID 24815876
[4-[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-(4-thiophen-3-yl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 24815876) has the molecular formula C26H26N4O5S3 and a molecular weight of 570.72 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-(4-thiophen-3-yl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-(4-thiophen-3-yl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24815876 |
| Molecular Formula | C26H26N4O5S3 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-(4-thiophen-3-yl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2ccsc2)cs1 |
| InChI | InChI=1S/C26H26N4O5S3/c1-17(31)27-22(13-18-5-3-2-4-6-18)25(32)28-23(26-29-24(16-37-26)20-11-12-36-15-20)14-19-7-9-21(10-8-19)30-38(33,34)35/h2-12,15-16,22-23,30H,13-14H2,1H3,(H,27,31)(H,28,32)(H,33,34,35)/t22-,23-/m0/s1 |
| InChIKey | LSQQLVVDVGLHHG-GOTSBHOMSA-N |
| XLogP | 4.23 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|