C21H29N3O6S2 — CID 24815971
[4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[(2S)-2-methoxycarbonyl-4-methylpentanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 24815971) has the molecular formula C21H29N3O6S2 and a molecular weight of 483.61 g/mol. Its IUPAC name is [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[(2S)-2-methoxycarbonyl-4-methylpentanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[(2S)-2-methoxycarbonyl-4-methylpentanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24815971 |
| Molecular Formula | C21H29N3O6S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[(2S)-2-methoxycarbonyl-4-methylpentanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)[C@H](CC(C)C)C(=O)OC)n1 |
| InChI | InChI=1S/C21H29N3O6S2/c1-5-15-12-31-20(22-15)18(23-19(25)17(10-13(2)3)21(26)30-4)11-14-6-8-16(9-7-14)24-32(27,28)29/h6-9,12-13,17-18,24H,5,10-11H2,1-4H3,(H,23,25)(H,27,28,29)/t17-,18-/m0/s1 |
| InChIKey | PHPUVRAXHKLHIQ-ROUUACIJSA-N |
| XLogP | 3.16 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|