C15H23NO4 — CID 24816049
4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,3,5-trimethyl-1-oxidopyridin-1-ium (PubChem CID 24816049) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,3,5-trimethyl-1-oxidopyridin-1-ium.
| Compound Name | 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,3,5-trimethyl-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 24816049 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,3,5-trimethyl-1-oxidopyridin-1-ium |
| SMILES | Cc1c[n+]([O-])c(C)c(C)c1OCC1COC(C)(C)OC1 |
| InChI | InChI=1S/C15H23NO4/c1-10-6-16(17)12(3)11(2)14(10)18-7-13-8-19-15(4,5)20-9-13/h6,13H,7-9H2,1-5H3 |
| InChIKey | RWPIQKXNCASAEC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|