C23H27N3O4S2 — CID 24816140
[4-[(2S)-2-(4-benzyl-1,3-thiazol-2-yl)-2-(2,2-dimethylpropanoylamino)ethyl]phenyl]sulfamic acid (PubChem CID 24816140) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is [4-[(2S)-2-(4-benzyl-1,3-thiazol-2-yl)-2-(2,2-dimethylpropanoylamino)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(4-benzyl-1,3-thiazol-2-yl)-2-(2,2-dimethylpropanoylamino)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24816140 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [4-[(2S)-2-(4-benzyl-1,3-thiazol-2-yl)-2-(2,2-dimethylpropanoylamino)ethyl]phenyl]sulfamic acid |
| SMILES | CC(C)(C)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc(Cc2ccccc2)cs1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-23(2,3)22(27)25-20(14-17-9-11-18(12-10-17)26-32(28,29)30)21-24-19(15-31-21)13-16-7-5-4-6-8-16/h4-12,15,20,26H,13-14H2,1-3H3,(H,25,27)(H,28,29,30)/t20-/m0/s1 |
| InChIKey | ZKDWAOAVSQQEJN-FQEVSTJZSA-N |
| XLogP | 4.39 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|