C28H24ClN7O3S2 — CID 24816406
N'-[4-[4-[(Z)-[(Z)-[3-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-3-phenylpyrazol-1-yl]phenyl]sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 24816406) has the molecular formula C28H24ClN7O3S2 and a molecular weight of 606.13 g/mol. Its IUPAC name is N'-[4-[4-[(Z)-[(Z)-[3-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-3-phenylpyrazol-1-yl]phenyl]sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[4-[(Z)-[(Z)-[3-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-3-phenylpyrazol-1-yl]phenyl]sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 24816406 |
| Molecular Formula | C28H24ClN7O3S2 |
| Molecular Weight | 606.13 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | N'-[4-[4-[(Z)-[(Z)-[3-(4-chlorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-3-phenylpyrazol-1-yl]phenyl]sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/S(=O)(=O)c1ccc(-n2cc(/C=N\N=C3/SCC(=O)N3c3ccc(Cl)cc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H24ClN7O3S2/c1-34(2)19-31-41(38,39)25-14-12-23(13-15-25)35-17-21(27(33-35)20-6-4-3-5-7-20)16-30-32-28-36(26(37)18-40-28)24-10-8-22(29)9-11-24/h3-17,19H,18H2,1-2H3/b30-16-,31-19+,32-28- |
| InChIKey | ZOIFEYWRVOGYAD-LAQXCBALSA-N |
| XLogP | 4.94 |
| TPSA | 112.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.13 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|