About [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate
[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate (PubChem CID 24816432) has the molecular formula C21H22N2O10S
and a molecular weight of 494.48 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate.
Molecular Properties
| Compound Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate |
| PubChem CID | 24816432 |
| Molecular Formula | C21H22N2O10S |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCO[N+](=O)[O-])ccc1OC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H22N2O10S/c1-30-19-14-15(5-11-20(24)31-12-2-3-13-32-23(26)27)4-10-18(19)33-21(25)16-6-8-17(9-7-16)34(22,28)29/h4-11,14H,2-3,12-13H2,1H3,(H2,22,28,29)/b11-5+ |
| InChIKey | WGWRQZCFJUOFIR-VZUCSPMQSA-N |
| XLogP | 2.11 |
| TPSA | 174.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate?
The IUPAC name of [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate (CID 24816432) is [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate.
What is the SMILES notation for [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate?
The canonical SMILES for [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate is COc1cc(/C=C/C(=O)OCCCCO[N+](=O)[O-])ccc1OC(=O)c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate?
The InChIKey is WGWRQZCFJUOFIR-VZUCSPMQSA-N. The full InChI is InChI=1S/C21H22N2O10S/c1-30-19-14-15(5-11-20(24)31-12-2-3-13-32-23(26)27)4-10-18(19)33-21(25)16-6-8-17(9-7-16)34(22,28)29/h4-11,14H,2-3,12-13H2,1H3,(H2,22,28,29)/b11-5+.
What are the key properties of [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate?
[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate has a molecular weight of 494.48 g/mol, XLogP of 2.11, 12 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfamoylbenzoate is sourced from PubChem (CID 24816432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).