About 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide
5-benzyl-1,4,5-oxathiazepane 4,4-dioxide (PubChem CID 24816509) has the molecular formula C11H15NO3S
and a molecular weight of 241.31 g/mol. Its IUPAC name is 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide.
Molecular Properties
| Compound Name | 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide |
| PubChem CID | 24816509 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide |
| SMILES | O=S1(=O)CCOCCN1Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO3S/c13-16(14)9-8-15-7-6-12(16)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | FARTVQRGKMXOFM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide?
The IUPAC name of 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide (CID 24816509) is 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide.
What is the SMILES notation for 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide?
The canonical SMILES for 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide is O=S1(=O)CCOCCN1Cc1ccccc1.
What is the InChIKey of 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide?
The InChIKey is FARTVQRGKMXOFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S/c13-16(14)9-8-15-7-6-12(16)10-11-4-2-1-3-5-11/h1-5H,6-10H2.
What are the key properties of 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide?
5-benzyl-1,4,5-oxathiazepane 4,4-dioxide has a molecular weight of 241.31 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1,4,5-oxathiazepane 4,4-dioxide is sourced from PubChem (CID 24816509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).