C21H27F3N2O2 — CID 24816652
1-cycloheptyl-6-oxo-N-[[2-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 24816652) has the molecular formula C21H27F3N2O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-cycloheptyl-6-oxo-N-[[2-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-cycloheptyl-6-oxo-N-[[2-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24816652 |
| Molecular Formula | C21H27F3N2O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-cycloheptyl-6-oxo-N-[[2-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1C(F)(F)F)C1CCC(=O)N(C2CCCCCC2)C1 |
| InChI | InChI=1S/C21H27F3N2O2/c22-21(23,24)18-10-6-5-7-15(18)13-25-20(28)16-11-12-19(27)26(14-16)17-8-3-1-2-4-9-17/h5-7,10,16-17H,1-4,8-9,11-14H2,(H,25,28) |
| InChIKey | GSQYCSWGMHFSBV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |