About N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide
N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide (PubChem CID 24816764) has the molecular formula C18H25N3O4
and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide.
Molecular Properties
| Compound Name | N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide |
| PubChem CID | 24816764 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide |
| SMILES | CC1CCCC(NC(=O)CCNC(=O)c2ccc([N+](=O)[O-])cc2)C1C |
| InChI | InChI=1S/C18H25N3O4/c1-12-4-3-5-16(13(12)2)20-17(22)10-11-19-18(23)14-6-8-15(9-7-14)21(24)25/h6-9,12-13,16H,3-5,10-11H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | BISFSMMUOBROKG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide?
The IUPAC name of N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide (CID 24816764) is N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide.
What is the SMILES notation for N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide?
The canonical SMILES for N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide is CC1CCCC(NC(=O)CCNC(=O)c2ccc([N+](=O)[O-])cc2)C1C.
What is the InChIKey of N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide?
The InChIKey is BISFSMMUOBROKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O4/c1-12-4-3-5-16(13(12)2)20-17(22)10-11-19-18(23)14-6-8-15(9-7-14)21(24)25/h6-9,12-13,16H,3-5,10-11H2,1-2H3,(H,19,23)(H,20,22).
What are the key properties of N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide?
N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide has a molecular weight of 347.42 g/mol, XLogP of 2.66, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2,3-dimethylcyclohexyl)amino]-3-oxopropyl]-4-nitrobenzamide is sourced from PubChem (CID 24816764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).