About [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone
[3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone (PubChem CID 24816858) has the molecular formula C19H25N3O2S
and a molecular weight of 359.50 g/mol. Its IUPAC name is [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 24816858 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone |
| SMILES | COc1ccc(NC2CCCN(C(=O)c3csc(C(C)C)n3)C2)cc1 |
| InChI | InChI=1S/C19H25N3O2S/c1-13(2)18-21-17(12-25-18)19(23)22-10-4-5-15(11-22)20-14-6-8-16(24-3)9-7-14/h6-9,12-13,15,20H,4-5,10-11H2,1-3H3 |
| InChIKey | RHRRAQPHABLKHD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone?
The IUPAC name of [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone (CID 24816858) is [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone is COc1ccc(NC2CCCN(C(=O)c3csc(C(C)C)n3)C2)cc1.
What is the InChIKey of [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone?
The InChIKey is RHRRAQPHABLKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O2S/c1-13(2)18-21-17(12-25-18)19(23)22-10-4-5-15(11-22)20-14-6-8-16(24-3)9-7-14/h6-9,12-13,15,20H,4-5,10-11H2,1-3H3.
What are the key properties of [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone?
[3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone has a molecular weight of 359.50 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methoxyanilino)piperidin-1-yl]-(2-propan-2-yl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 24816858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).