C16H10F4N2O3 — CID 24816947
4-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 24816947) has the molecular formula C16H10F4N2O3 and a molecular weight of 354.26 g/mol. Its IUPAC name is 4-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 24816947 |
| Molecular Formula | C16H10F4N2O3 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)COc2c(F)c(F)cc(F)c2F)c2ccccc2N1 |
| InChI | InChI=1S/C16H10F4N2O3/c17-8-5-9(18)15(20)16(14(8)19)25-7-13(24)22-6-12(23)21-10-3-1-2-4-11(10)22/h1-5H,6-7H2,(H,21,23) |
| InChIKey | FLLQMIVJZRBSIP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|