About 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one
1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one (PubChem CID 24816963) has the molecular formula C18H23F2N3O2
and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one |
| PubChem CID | 24816963 |
| Molecular Formula | C18H23F2N3O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCC(=O)N1CCCC(Nc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C18H23F2N3O2/c19-15-6-5-13(11-16(15)20)21-14-3-1-9-23(12-14)18(25)7-10-22-8-2-4-17(22)24/h5-6,11,14,21H,1-4,7-10,12H2 |
| InChIKey | HTCPBJLHAOBSOJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one?
The IUPAC name of 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one (CID 24816963) is 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one?
The canonical SMILES for 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one is O=C1CCCN1CCC(=O)N1CCCC(Nc2ccc(F)c(F)c2)C1.
What is the InChIKey of 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one?
The InChIKey is HTCPBJLHAOBSOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F2N3O2/c19-15-6-5-13(11-16(15)20)21-14-3-1-9-23(12-14)18(25)7-10-22-8-2-4-17(22)24/h5-6,11,14,21H,1-4,7-10,12H2.
What are the key properties of 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one?
1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one has a molecular weight of 351.40 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[3-(3,4-difluoroanilino)piperidin-1-yl]-3-oxopropyl]pyrrolidin-2-one is sourced from PubChem (CID 24816963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).