C21H29FN2O2 — CID 24817106
N-(3-cyclopentylpropyl)-1-[(3-fluorophenyl)methyl]-6-oxopiperidine-3-carboxamide (PubChem CID 24817106) has the molecular formula C21H29FN2O2 and a molecular weight of 360.47 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-1-[(3-fluorophenyl)methyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(3-cyclopentylpropyl)-1-[(3-fluorophenyl)methyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 24817106 |
| Molecular Formula | C21H29FN2O2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-(3-cyclopentylpropyl)-1-[(3-fluorophenyl)methyl]-6-oxopiperidine-3-carboxamide |
| SMILES | O=C(NCCCC1CCCC1)C1CCC(=O)N(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C21H29FN2O2/c22-19-9-3-7-17(13-19)14-24-15-18(10-11-20(24)25)21(26)23-12-4-8-16-5-1-2-6-16/h3,7,9,13,16,18H,1-2,4-6,8,10-12,14-15H2,(H,23,26) |
| InChIKey | VTEIPYSWKYFUSN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|