C21H25N5O5 — CID 24817142
[4-(2-methoxyethoxy)piperidin-1-yl]-[5-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]-1,2-oxazol-3-yl]methanone (PubChem CID 24817142) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)piperidin-1-yl]-[5-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]-1,2-oxazol-3-yl]methanone.
| Compound Name | [4-(2-methoxyethoxy)piperidin-1-yl]-[5-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 24817142 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [4-(2-methoxyethoxy)piperidin-1-yl]-[5-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]-1,2-oxazol-3-yl]methanone |
| SMILES | COCCOC1CCN(C(=O)c2cc(COc3ccc(-n4cncn4)cc3)on2)CC1 |
| InChI | InChI=1S/C21H25N5O5/c1-28-10-11-29-18-6-8-25(9-7-18)21(27)20-12-19(31-24-20)13-30-17-4-2-16(3-5-17)26-15-22-14-23-26/h2-5,12,14-15,18H,6-11,13H2,1H3 |
| InChIKey | ITDHKECQCKSWQV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|