C18H20ClNO4S — CID 24817186
7-chloro-N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-N-prop-2-enyl-1-benzofuran-2-carboxamide (PubChem CID 24817186) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is 7-chloro-N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-N-prop-2-enyl-1-benzofuran-2-carboxamide.
| Compound Name | 7-chloro-N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-N-prop-2-enyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 24817186 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 7-chloro-N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-N-prop-2-enyl-1-benzofuran-2-carboxamide |
| SMILES | C=CCN(C(=O)c1oc2c(Cl)cc(C)cc2c1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-4-6-20(13-5-7-25(22,23)10-13)18(21)16-12(3)14-8-11(2)9-15(19)17(14)24-16/h4,8-9,13H,1,5-7,10H2,2-3H3 |
| InChIKey | FKZQJPNVSWBUCP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|