About 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide
5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide (PubChem CID 24817239) has the molecular formula C22H24N2O3
and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 24817239 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccc(OCc2cc(C(=O)NCC(C)c3ccccc3)no2)cc1C |
| InChI | InChI=1S/C22H24N2O3/c1-15-9-10-19(11-16(15)2)26-14-20-12-21(24-27-20)22(25)23-13-17(3)18-7-5-4-6-8-18/h4-12,17H,13-14H2,1-3H3,(H,23,25) |
| InChIKey | FRWYGLRPIPRUJB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide (CID 24817239) is 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide is Cc1ccc(OCc2cc(C(=O)NCC(C)c3ccccc3)no2)cc1C.
What is the InChIKey of 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide?
The InChIKey is FRWYGLRPIPRUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3/c1-15-9-10-19(11-16(15)2)26-14-20-12-21(24-27-20)22(25)23-13-17(3)18-7-5-4-6-8-18/h4-12,17H,13-14H2,1-3H3,(H,23,25).
What are the key properties of 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide?
5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide has a molecular weight of 364.45 g/mol, XLogP of 4.40, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dimethylphenoxy)methyl]-N-(2-phenylpropyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 24817239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).