C20H20N4O3S3 — CID 2481727
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide (PubChem CID 2481727) has the molecular formula C20H20N4O3S3 and a molecular weight of 460.61 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2481727 |
| Molecular Formula | C20H20N4O3S3 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)Nc2nnc(SCC)s2)c1 |
| InChI | InChI=1S/C20H20N4O3S3/c1-3-13-24(16-10-6-5-7-11-16)30(26,27)17-12-8-9-15(14-17)18(25)21-19-22-23-20(29-19)28-4-2/h3,5-12,14H,1,4,13H2,2H3,(H,21,22,25) |
| InChIKey | HHVAFBXBTMFWAR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|