About N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide
N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide (PubChem CID 24817394) has the molecular formula C21H25FN6O
and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide.
Molecular Properties
| Compound Name | N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide |
| PubChem CID | 24817394 |
| Molecular Formula | C21H25FN6O |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide |
| SMILES | Cc1c(CN2CCC(n3nccc3NC(=O)c3cccc(F)c3)CC2)cnn1C |
| InChI | InChI=1S/C21H25FN6O/c1-15-17(13-24-26(15)2)14-27-10-7-19(8-11-27)28-20(6-9-23-28)25-21(29)16-4-3-5-18(22)12-16/h3-6,9,12-13,19H,7-8,10-11,14H2,1-2H3,(H,25,29) |
| InChIKey | PHEIUSCNQWYTIG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide?
The IUPAC name of N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide (CID 24817394) is N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide.
What is the SMILES notation for N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide?
The canonical SMILES for N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide is Cc1c(CN2CCC(n3nccc3NC(=O)c3cccc(F)c3)CC2)cnn1C.
What is the InChIKey of N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide?
The InChIKey is PHEIUSCNQWYTIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25FN6O/c1-15-17(13-24-26(15)2)14-27-10-7-19(8-11-27)28-20(6-9-23-28)25-21(29)16-4-3-5-18(22)12-16/h3-6,9,12-13,19H,7-8,10-11,14H2,1-2H3,(H,25,29).
What are the key properties of N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide?
N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide has a molecular weight of 396.47 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-fluorobenzamide is sourced from PubChem (CID 24817394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).