About [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone
[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone (PubChem CID 24817431) has the molecular formula C21H28N2O4S
and a molecular weight of 404.53 g/mol. Its IUPAC name is [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone.
Molecular Properties
| Compound Name | [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone |
| PubChem CID | 24817431 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone |
| SMILES | CCCc1ccc2oc(C(=O)N3CCN(C4CCS(=O)(=O)C4)CC3)c(C)c2c1 |
| InChI | InChI=1S/C21H28N2O4S/c1-3-4-16-5-6-19-18(13-16)15(2)20(27-19)21(24)23-10-8-22(9-11-23)17-7-12-28(25,26)14-17/h5-6,13,17H,3-4,7-12,14H2,1-2H3 |
| InChIKey | QLKLREPLZQBOIH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone?
The IUPAC name of [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone (CID 24817431) is [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone.
What is the SMILES notation for [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone?
The canonical SMILES for [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone is CCCc1ccc2oc(C(=O)N3CCN(C4CCS(=O)(=O)C4)CC3)c(C)c2c1.
What is the InChIKey of [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone?
The InChIKey is QLKLREPLZQBOIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O4S/c1-3-4-16-5-6-19-18(13-16)15(2)20(27-19)21(24)23-10-8-22(9-11-23)17-7-12-28(25,26)14-17/h5-6,13,17H,3-4,7-12,14H2,1-2H3.
What are the key properties of [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone?
[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone has a molecular weight of 404.53 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(3-methyl-5-propyl-1-benzofuran-2-yl)methanone is sourced from PubChem (CID 24817431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).