About [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone (PubChem CID 24817467) has the molecular formula C16H18FNO3
and a molecular weight of 291.32 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone.
Molecular Properties
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone |
| PubChem CID | 24817467 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2C[C@@H](C)O[C@@H](C)C2)oc2c(F)cccc12 |
| InChI | InChI=1S/C16H18FNO3/c1-9-7-18(8-10(2)20-9)16(19)14-11(3)12-5-4-6-13(17)15(12)21-14/h4-6,9-10H,7-8H2,1-3H3/t9-,10+ |
| InChIKey | AEMBSLWWWANLME-AOOOYVTPSA-N |
| XLogP | 3.13 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The IUPAC name of [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone (CID 24817467) is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone.
What is the SMILES notation for [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The canonical SMILES for [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone is Cc1c(C(=O)N2C[C@@H](C)O[C@@H](C)C2)oc2c(F)cccc12.
What is the InChIKey of [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The InChIKey is AEMBSLWWWANLME-AOOOYVTPSA-N. The full InChI is InChI=1S/C16H18FNO3/c1-9-7-18(8-10(2)20-9)16(19)14-11(3)12-5-4-6-13(17)15(12)21-14/h4-6,9-10H,7-8H2,1-3H3/t9-,10+.
What are the key properties of [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone has a molecular weight of 291.32 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone is sourced from PubChem (CID 24817467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).