C22H32N4OS — CID 24817764
N-[2-[1-(1-methylsulfanylpropan-2-yl)piperidin-4-yl]pyrazol-3-yl]-4-phenylbutanamide (PubChem CID 24817764) has the molecular formula C22H32N4OS and a molecular weight of 400.59 g/mol. Its IUPAC name is N-[2-[1-(1-methylsulfanylpropan-2-yl)piperidin-4-yl]pyrazol-3-yl]-4-phenylbutanamide.
| Compound Name | N-[2-[1-(1-methylsulfanylpropan-2-yl)piperidin-4-yl]pyrazol-3-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 24817764 |
| Molecular Formula | C22H32N4OS |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[2-[1-(1-methylsulfanylpropan-2-yl)piperidin-4-yl]pyrazol-3-yl]-4-phenylbutanamide |
| SMILES | CSCC(C)N1CCC(n2nccc2NC(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H32N4OS/c1-18(17-28-2)25-15-12-20(13-16-25)26-21(11-14-23-26)24-22(27)10-6-9-19-7-4-3-5-8-19/h3-5,7-8,11,14,18,20H,6,9-10,12-13,15-17H2,1-2H3,(H,24,27) |
| InChIKey | BHYAULUEHLOREL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |