C23H23F2N3O4 — CID 24817766
N-[1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,3,4-trimethoxybenzamide (PubChem CID 24817766) has the molecular formula C23H23F2N3O4 and a molecular weight of 443.45 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 24817766 |
| Molecular Formula | C23H23F2N3O4 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCCc3c2cnn3-c2cc(F)cc(F)c2)c(OC)c1OC |
| InChI | InChI=1S/C23H23F2N3O4/c1-30-20-8-7-16(21(31-2)22(20)32-3)23(29)27-18-5-4-6-19-17(18)12-26-28(19)15-10-13(24)9-14(25)11-15/h7-12,18H,4-6H2,1-3H3,(H,27,29) |
| InChIKey | XJSLGFLEWBJOQG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |