About [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone
[2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone (PubChem CID 24817878) has the molecular formula C21H23N3O4
and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone.
Molecular Properties
| Compound Name | [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone |
| PubChem CID | 24817878 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone |
| SMILES | COCC1CCCCN1C(=O)c1cc(COc2ccc3ncccc3c2)on1 |
| InChI | InChI=1S/C21H23N3O4/c1-26-13-16-6-2-3-10-24(16)21(25)20-12-18(28-23-20)14-27-17-7-8-19-15(11-17)5-4-9-22-19/h4-5,7-9,11-12,16H,2-3,6,10,13-14H2,1H3 |
| InChIKey | FMPNDJVBSMJRSW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone?
The IUPAC name of [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone (CID 24817878) is [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone.
What is the SMILES notation for [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone?
The canonical SMILES for [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone is COCC1CCCCN1C(=O)c1cc(COc2ccc3ncccc3c2)on1.
What is the InChIKey of [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone?
The InChIKey is FMPNDJVBSMJRSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O4/c1-26-13-16-6-2-3-10-24(16)21(25)20-12-18(28-23-20)14-27-17-7-8-19-15(11-17)5-4-9-22-19/h4-5,7-9,11-12,16H,2-3,6,10,13-14H2,1H3.
What are the key properties of [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone?
[2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone has a molecular weight of 381.43 g/mol, XLogP of 3.44, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methoxymethyl)piperidin-1-yl]-[5-(quinolin-6-yloxymethyl)-1,2-oxazol-3-yl]methanone is sourced from PubChem (CID 24817878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).