C21H24N2O6S — CID 24817979
[1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(4-acetamidophenyl)sulfonylamino]propanoate (PubChem CID 24817979) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is [1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(4-acetamidophenyl)sulfonylamino]propanoate.
| Compound Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(4-acetamidophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 24817979 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(4-acetamidophenyl)sulfonylamino]propanoate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)OC(C)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O6S/c1-14-4-6-17(7-5-14)21(26)15(2)29-20(25)12-13-22-30(27,28)19-10-8-18(9-11-19)23-16(3)24/h4-11,15,22H,12-13H2,1-3H3,(H,23,24) |
| InChIKey | LHCODTVGPCWAML-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |