About (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate
(2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 24818025) has the molecular formula C20H24N2O4S
and a molecular weight of 388.49 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate.
Molecular Properties
| Compound Name | (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate |
| PubChem CID | 24818025 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | Cc1ccc(C)c(OC(=O)c2cccc(S(=O)(=O)N3CCN(C)CC3)c2)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-15-7-8-16(2)19(13-15)26-20(23)17-5-4-6-18(14-17)27(24,25)22-11-9-21(3)10-12-22/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | OEWITSHJNHWRLX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate?
The IUPAC name of (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate (CID 24818025) is (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate.
What is the SMILES notation for (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate?
The canonical SMILES for (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate is Cc1ccc(C)c(OC(=O)c2cccc(S(=O)(=O)N3CCN(C)CC3)c2)c1.
What is the InChIKey of (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate?
The InChIKey is OEWITSHJNHWRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O4S/c1-15-7-8-16(2)19(13-15)26-20(23)17-5-4-6-18(14-17)27(24,25)22-11-9-21(3)10-12-22/h4-8,13-14H,9-12H2,1-3H3.
What are the key properties of (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate?
(2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate has a molecular weight of 388.49 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylphenyl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate is sourced from PubChem (CID 24818025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).