C19H24N4O8 — CID 24818065
[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 24818065) has the molecular formula C19H24N4O8 and a molecular weight of 436.42 g/mol. Its IUPAC name is [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 24818065 |
| Molecular Formula | C19H24N4O8 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OC(C)C(=O)Nc2cc([N+](=O)[O-])ccc2OC)C1=O |
| InChI | InChI=1S/C19H24N4O8/c1-5-19(6-2)17(26)22(18(27)21-19)10-15(24)31-11(3)16(25)20-13-9-12(23(28)29)7-8-14(13)30-4/h7-9,11H,5-6,10H2,1-4H3,(H,20,25)(H,21,27) |
| InChIKey | DBOWPVDSMIDVCX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|