About [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate
[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate (PubChem CID 24818158) has the molecular formula C17H23N3O7S
and a molecular weight of 413.45 g/mol. Its IUPAC name is [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate.
Molecular Properties
| Compound Name | [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate |
| PubChem CID | 24818158 |
| Molecular Formula | C17H23N3O7S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate |
| SMILES | CCC(C)N(C(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23N3O7S/c1-3-11(2)19(13-6-7-28(25,26)10-13)16(21)9-27-17(22)14-8-12(20(23)24)4-5-15(14)18/h4-5,8,11,13H,3,6-7,9-10,18H2,1-2H3 |
| InChIKey | OWOWWEZUEFNCMU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate?
The IUPAC name of [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate (CID 24818158) is [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate.
What is the SMILES notation for [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate?
The canonical SMILES for [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate is CCC(C)N(C(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate?
The InChIKey is OWOWWEZUEFNCMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O7S/c1-3-11(2)19(13-6-7-28(25,26)10-13)16(21)9-27-17(22)14-8-12(20(23)24)4-5-15(14)18/h4-5,8,11,13H,3,6-7,9-10,18H2,1-2H3.
What are the key properties of [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate?
[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate has a molecular weight of 413.45 g/mol, XLogP of 1.15, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-amino-5-nitrobenzoate is sourced from PubChem (CID 24818158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).