About N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide
N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide (PubChem CID 24818176) has the molecular formula C16H23NO4S
and a molecular weight of 325.43 g/mol. Its IUPAC name is N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide |
| PubChem CID | 24818176 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1cccc(C(=O)NC2(C)CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C16H23NO4S/c1-12(2)10-21-14-6-4-5-13(9-14)15(18)17-16(3)7-8-22(19,20)11-16/h4-6,9,12H,7-8,10-11H2,1-3H3,(H,17,18) |
| InChIKey | CKIXYUNCJXKZAF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide?
The IUPAC name of N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide (CID 24818176) is N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide.
What is the SMILES notation for N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide?
The canonical SMILES for N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide is CC(C)COc1cccc(C(=O)NC2(C)CCS(=O)(=O)C2)c1.
What is the InChIKey of N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide?
The InChIKey is CKIXYUNCJXKZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4S/c1-12(2)10-21-14-6-4-5-13(9-14)15(18)17-16(3)7-8-22(19,20)11-16/h4-6,9,12H,7-8,10-11H2,1-3H3,(H,17,18).
What are the key properties of N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide?
N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide has a molecular weight of 325.43 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropoxy)benzamide is sourced from PubChem (CID 24818176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).